![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 00. play.m3u | 2024-10-25 16:05 | 1.7K | |
| 01. Baz Luhrmann - E..> | 2024-10-25 21:16 | 28M | |
| 02. Texas - In Our L..> | 2024-10-25 21:10 | 30M | |
| 03. New Radicals - Y..> | 2024-10-25 20:35 | 37M | |
| 04. Supergrass - Pum..> | 2024-10-25 20:45 | 25M | |
| 05. Madness - Lovest..> | 2024-10-25 16:06 | 28M | |
| 06. The Wiseguys - O..> | 2024-10-25 19:59 | 23M | |
| 07. The Chemical Bro..> | 2024-10-25 20:26 | 32M | |
| 08. Fatboy Slim - Ri..> | 2024-10-25 20:16 | 37M | |
| 09. Chicane Feat. Ma..> | 2024-10-25 19:42 | 24M | |
| 10. Bryan Adams - Cl..> | 2024-10-25 21:25 | 33M | |
| 11. Blur - Coffee & ..> | 2024-10-25 21:24 | 37M | |
| 12. Cast - Beat Mama..> | 2024-10-25 20:42 | 28M | |
| 13. Stereophonics - ..> | 2024-10-25 20:37 | 28M | |
| 14. Gomez - Bring It..> | 2024-10-25 16:06 | 28M | |
| 15. Semisonic - Secr..> | 2024-10-25 20:13 | 26M | |
| 16. James - I Know W..> | 2024-10-25 20:49 | 31M | |
| 17. Yomanda - Synth ..> | 2024-10-25 16:06 | 25M | |
| 18. DJ Jurgen Presen..> | 2024-10-25 20:28 | 26M | |
| 19. Masters At Work ..> | 2024-10-25 20:51 | 26M | |
| CD2.cd2.cuetools.fla..> | 2024-10-25 16:06 | 1.8K | |
| cover.jpg | 2024-10-25 16:07 | 746K | |
