Index of /Music/Drum N Bass/Liam New Drum and Bass
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | Awake [ ezmp3.cc ].mp3 | 2024-10-10 19:56 | 5.7M | |
| Malfunction [ ezmp3...> | 2024-10-10 20:02 | 3.1M | |
| Sub Focus & Pola & B..> | 2024-10-10 20:04 | 3.5M | |
| Atmos-Nasty [ ezmp3...> | 2024-10-10 20:05 | 4.1M | |
| Sota - Pray For Me [..> | 2024-10-10 20:07 | 2.8M | |
| Bru-C - You & I (Bou..> | 2024-10-10 20:11 | 3.1M | |
| Chase & Status, Bou ..> | 2024-10-10 20:14 | 2.9M | |
| Amplify & P Money - ..> | 2024-10-10 20:16 | 2.3M | |
| Maroon 5 - Animals (..> | 2024-10-10 20:27 | 4.4M | |
| Man Come Back [ ezmp..> | 2024-10-10 20:37 | 3.3M | |
| Fred again.. x Swedi..> | 2024-10-10 20:41 | 3.4M | |
| MIA - Paper Planes (..> | 2024-10-10 20:42 | 1.7M | |
| Sub Focus X Dimensio..> | 2024-10-10 20:49 | 4.3M | |
| Mefjus & Camo & Kroo..> | 2024-10-10 20:51 | 3.6M | |
| Armin van Buuren - L..> | 2024-10-10 20:55 | 2.9M | |
| Dimension - Saviour ..> | 2024-10-10 20:55 | 4.1M | |
| Andromedik - Bleed T..> | 2024-10-13 20:02 | 3.7M | |
| Bru-C - Wild (Disrup..> | 2024-10-13 20:11 | 2.8M | |
| Worth The Love [ ezm..> | 2024-10-13 20:15 | 3.8M | |
| K Motionz, ArrDee ft..> | 2024-10-13 20:17 | 2.1M | |
| Tiësto x Hedex x Ba..> | 2024-10-22 18:35 | 2.6M | |
| Keys & Krates - Dum ..> | 2024-11-01 20:49 | 2.9M | |
| HEADIE ONE x SKEPTA ..> | 2024-11-01 20:51 | 4.1M | |
| Pirapus - GO BACK (W..> | 2024-11-01 20:53 | 3.4M | |
| through it all hedex..> | 2024-11-02 09:25 | 3.5M | |
| Kings_Of_Leon_-_Sex_..> | 2024-11-08 17:41 | 6.0M | |
| 1Pendulum_-_Tarantul..> | 2024-11-09 07:58 | 5.7M | |
| balling spy remix.mp3 | 2024-11-17 14:13 | 3.8M | |
| Atmos_-_Alarm_VIP__D..> | 2024-11-19 19:33 | 12M | |
| dj fresh martians.mp3 | 2024-11-29 16:15 | 3.2M | |
| sota realise.mp3 | 2024-11-30 15:27 | 2.9M | |
| 1991 rova remix.mp3 | 2024-12-06 16:38 | 3.3M | |
| sota round and round..> | 2024-12-06 16:38 | 2.4M | |
| blow the roof pirapu..> | 2024-12-06 16:39 | 3.2M | |
| Brum to Ibiza (Jaybe..> | 2024-12-06 16:54 | 4.2M | |
| Serum_vs__The_Riddle..> | 2024-12-06 16:54 | 6.8M | |
| F# That [ ezmp3.cc ]..> | 2024-12-06 16:54 | 3.4M | |
| Hamdi - Counting (Si..> | 2024-12-06 16:54 | 4.0M | |
| Sota-Wait For Me [ e..> | 2024-12-06 16:54 | 2.6M | |
| Wicked___Dark_320k_S..> | 2024-12-06 16:55 | 7.3M | |
| Entity___Yen_-_Snake..> | 2024-12-06 16:55 | 9.5M | |
| Kid Cudi - Day N Nit..> | 2024-12-06 16:55 | 3.8M | |
| Bicep_-_Glue__Kanine..> | 2024-12-06 16:55 | 8.7M | |
| Carpet Burn [ ezmp3...> | 2024-12-06 16:56 | 3.1M | |
| mhitr hedex.mp3 | 2024-12-06 16:56 | 2.7M | |
| Holy Goof - Untoucha..> | 2024-12-06 16:56 | 4.4M | |
| Culture Shock X Wilk..> | 2024-12-06 16:56 | 3.8M | |
| Wish You Were Mine [..> | 2024-12-06 16:56 | 2.8M | |
| JAZZY - NRG (Disrupt..> | 2024-12-06 16:57 | 2.5M | |
| Kanine - Light It Up..> | 2024-12-06 16:57 | 3.4M | |
| Metrik - Utopia [ ez..> | 2024-12-06 16:57 | 3.9M | |
| THE_PROTOTYPES_-_LIG..> | 2024-12-06 16:59 | 9.9M | |
| Wilkinson - Dirty Lo..> | 2024-12-06 17:00 | 3.4M | |
| Kings Of Leon - Use ..> | 2024-12-12 15:44 | 3.0M | |
| Serum & Basslayerz -..> | 2024-12-12 15:58 | 6.1M | |
| chase and status del..> | 2024-12-21 15:15 | 2.8M | |
| breathe prodigy camo..> | 2024-12-21 15:17 | 3.4M | |
| pirate material furn..> | 2024-12-21 15:23 | 2.2M | |
| i like it dreadnaugh..> | 2024-12-21 16:02 | 4.1M | |
| Benny Benassi presen..> | 2024-12-21 16:15 | 3.0M | |
| hdilla dont want smo..> | 2024-12-21 16:15 | 4.0M | |
| daymu revolution.mp3 | 2024-12-21 16:39 | 3.5M | |
| Armin van Buuren - B..> | 2024-12-21 16:39 | 4.6M | |
| aaaaaa.mp3 | 2024-12-21 17:27 | 3.4M | |
| dead limit.mp3 | 2025-01-03 14:46 | 3.7M | |
| cadence vip.mp3 | 2025-01-03 14:53 | 3.5M | |
| scatta.mp3 | 2025-01-03 14:54 | 2.5M | |
| Sota - Destruction [..> | 2025-01-03 15:06 | 19M | |
| Sota - Too Close Boo..> | 2025-01-03 15:07 | 24M | |
| Sota - POW 2011 [TES..> | 2025-01-03 15:35 | 20M | |
| safe for the block.mp3 | 2025-01-03 15:40 | 2.6M | |
| i see you bby.mp3 | 2025-01-03 15:41 | 3.5M | |
| haunted.mp3 | 2025-01-11 16:02 | 2.7M | |
| the shadows.mp3 | 2025-01-11 16:03 | 4.0M | |
| j bookey the inside.mp3 | 2025-01-11 16:05 | 2.7M | |
| Arcando - Buss Back ..> | 2025-01-11 16:53 | 3.1M | |
| raving in studio.mp3 | 2025-01-17 13:40 | 2.8M | |
| jaybee sounds.mp3 | 2025-01-17 13:41 | 2.9M | |
| sugarabes.mp3 | 2025-01-17 13:42 | 3.2M | |
| air.mp3 | 2025-01-17 13:44 | 3.1M | |
| who knows.mp3 | 2025-01-17 13:47 | 3.8M | |
| tell me why.mp3 | 2025-01-17 13:47 | 3.7M | |
| keep pushing.mp3 | 2025-01-17 13:48 | 2.9M | |
| go back.mp3 | 2025-01-17 14:10 | 3.4M | |
| devotion solar.mp3 | 2025-01-17 14:10 | 4.3M | |
| cluster.mp3 | 2025-01-17 14:10 | 3.8M | |
| good to me.mp3 | 2025-01-25 10:01 | 3.8M | |
| back to me.mp3 | 2025-01-25 10:02 | 3.9M | |
| reload.mp3 | 2025-01-25 10:08 | 4.0M | |
| leave m alone sudley..> | 2025-01-25 10:08 | 3.3M | |
| bang.mp3 | 2025-01-25 10:09 | 2.6M | |
| wicked and bad.mp3 | 2025-01-25 10:16 | 2.6M | |
| reload real.mp3 | 2025-01-25 16:54 | 4.0M | |
| samba.mp3 | 2025-02-01 15:31 | 3.8M | |
| biana.mp3 | 2025-02-01 15:33 | 4.0M | |
| black wiidow.mp3 | 2025-02-01 15:34 | 3.4M | |
| helix.mp3 | 2025-02-01 15:35 | 3.5M | |
| las.mp3 | 2025-02-01 17:08 | 2.5M | |
| desire.mp3 | 2025-02-07 17:48 | 4.1M | |
| airmax.mp3 | 2025-02-07 17:48 | 2.8M | |
| Pendulum_-_Tarantula..> | 2025-02-15 01:01 | 5.8M | |
| Sigma_ft_Doktor_-_Ru..> | 2025-02-15 01:02 | 8.7M | |
| UK_Apache___Shy_FX_-..> | 2025-02-15 01:02 | 7.8M | |
| Fred Again.. x Cultu..> | 2025-02-15 01:13 | 3.4M | |
| alarm.mp3 | 2025-02-15 12:29 | 4.3M | |
| mr happy.mp3 | 2025-02-18 22:40 | 4.8M | |
| j bookey ram.mp3 | 2025-02-19 01:26 | 4.6M | |
| whip.mp3 | 2025-02-19 01:28 | 3.5M | |
| jauz.mp3 | 2025-02-19 01:29 | 3.9M | |
| HEAVEN.mp3 | 2025-02-20 01:35 | 3.1M | |
| TAKE YOU HIGHER.mp3 | 2025-02-20 01:36 | 3.1M | |
| take you higher vip.mp3 | 2025-02-20 01:37 | 3.3M | |
| break.mp3 | 2025-02-20 01:38 | 4.4M | |
| roots.mp3 | 2025-02-20 01:41 | 3.5M | |
| solar.mp3 | 2025-02-20 15:41 | 4.4M | |
| higheer.mp3 | 2025-02-20 15:42 | 2.9M | |
| rendah.mp3 | 2025-02-20 15:43 | 4.0M | |
| space.mp3 | 2025-02-20 16:02 | 4.1M | |
| action.mp3 | 2025-02-20 23:20 | 2.8M | |
| get outta here.mp3 | 2025-02-21 01:48 | 2.4M | |
| laser.mp3 | 2025-02-21 22:32 | 2.5M | |
| exhibit 9.mp3 | 2025-02-21 22:33 | 2.0M | |
| grooving.mp3 | 2025-02-21 22:34 | 3.3M | |
| ascend.mp3 | 2025-02-21 22:42 | 0 | |
| ascendd.mp3 | 2025-02-21 22:44 | 1.7M | |
| move.mp3 | 2025-02-22 02:58 | 3.1M | |
| bass.mp3 | 2025-02-22 03:20 | 2.4M | |
| alteria.mp3 | 2025-02-24 00:56 | 4.0M | |
| shtudwon.mp3 | 2025-02-24 00:57 | 4.0M | |
| shutdown vip.mp3 | 2025-02-24 00:58 | 4.1M | |
| circles.mp3 | 2025-02-24 15:55 | 4.1M | |
| on the.mp3 | 2025-02-24 15:56 | 3.2M | |
| on.mp3 | 2025-02-24 15:58 | 3.2M | |
| dread.mp3 | 2025-03-01 01:32 | 4.1M | |
| kelvin.mp3 | 2025-03-01 01:34 | 3.9M | |
| jump up.mp3 | 2025-03-01 01:36 | 1.7M | |
| click.mp3 | 2025-03-01 03:30 | 2.6M | |
| herbz.mp3 | 2025-03-01 03:30 | 3.5M | |
| back.mp3 | 2025-03-01 17:26 | 2.5M | |
| pump.mp3 | 2025-03-01 18:44 | 2.6M | |
| all you.mp3 | 2025-03-01 19:27 | 3.5M | |
| push.mp3 | 2025-03-01 22:34 | 2.4M | |
| take me up.mp3 | 2025-03-01 23:01 | 3.3M | |
| want you.mp3 | 2025-03-01 23:04 | 3.8M | |
| posh.mp3 | 2025-03-01 23:21 | 2.9M | |
| gold.mp3 | 2025-03-01 23:22 | 5.2M | |
| asap.mp3 | 2025-03-02 19:14 | 3.7M | |
| 1.mp3 | 2025-03-03 17:39 | 2.9M | |
| 2.mp3 | 2025-03-03 17:39 | 4.0M | |
| 3.mp3 | 2025-03-03 17:40 | 3.5M | |
| 4.mp3 | 2025-03-03 17:41 | 3.9M | |
| 5.mp3 | 2025-03-03 17:41 | 4.4M | |
| 6.mp3 | 2025-03-03 17:42 | 3.5M | |
| 7.mp3 | 2025-03-03 17:43 | 2.8M | |
| 8.mp3 | 2025-03-03 17:44 | 3.1M | |
| strangers.mp3 | 2025-03-05 13:55 | 3.8M | |
| take.mp3 | 2025-03-05 14:02 | 3.1M | |
| clickkk.mp3 | 2025-03-05 15:48 | 3.6M | |
| thats not.mp3 | 2025-03-07 18:28 | 4.2M | |
| room.mp3 | 2025-03-07 18:29 | 3.5M | |
| mission.mp3 | 2025-03-07 18:30 | 4.2M | |
| omen.mp3 | 2025-03-07 18:31 | 4.6M | |
| artict.mp3 | 2025-03-07 18:32 | 2.2M | |
| cheese.mp3 | 2025-03-07 18:32 | 3.5M | |
| this moment.mp3 | 2025-03-07 18:33 | 3.3M | |
| sheck.mp3 | 2025-03-07 18:39 | 3.9M | |
| dont tell me.mp3 | 2025-03-07 18:40 | 0 | |
| out of space.mp3 | 2025-03-07 18:41 | 3.8M | |
| donttt.mp3 | 2025-03-07 18:44 | 2.8M | |
| eyes.mp3 | 2025-03-08 18:15 | 3.4M | |
| nasty.mp3 | 2025-03-08 18:52 | 0 | |
| nastyyy.mp3 | 2025-03-08 18:53 | 3.6M | |
| BOU - 0961 ft. B LIV..> | 2025-03-09 21:44 | 12M | |
| BOU - ALL U GOTTA DO..> | 2025-03-09 21:44 | 9.2M | |
| BOU - FUCK _ UP VIP ..> | 2025-03-09 21:45 | 8.4M | |
| ALARMM.mp3 | 2025-03-11 20:32 | 2.0M | |
| where.mp3 | 2025-03-11 20:33 | 2.9M | |
| poloce.mp3 | 2025-03-11 20:34 | 2.7M | |
| make.mp3 | 2025-03-11 20:35 | 0 | |
| go back remix.mp3 | 2025-03-11 20:37 | 3.2M | |
| shutdownnn.mp3 | 2025-03-11 20:37 | 0 | |
| maaake.mp3 | 2025-03-11 20:39 | 3.3M | |
| shellaz.mp3 | 2025-03-11 20:40 | 0 | |
| 21.mp3 | 2025-03-11 20:41 | 2.8M | |
| spire.mp3 | 2025-03-11 23:41 | 3.9M | |
| groovingg.mp3 | 2025-03-12 00:35 | 3.5M | |
| h20.mp3 | 2025-03-14 19:28 | 2.4M | |
| speechify_cloned_voi..> | 2025-03-14 21:18 | 10K | |
| Unknown Artist - SHR..> | 2025-03-14 21:39 | 5.4M | |
| srry.mp3 | 2025-03-16 18:52 | 4.1M | |
| eric.mp3 | 2025-03-16 19:43 | 3.5M | |
| 98.mp3 | 2025-03-16 19:43 | 4.9M | |
| K Motionz, Clavish -..> | 2025-03-17 20:07 | 7.1M | |
| Knife Party - Intern..> | 2025-03-17 20:09 | 44M | |
| 11891826_All For You..> | 2025-03-17 20:11 | 10M | |
| SOTA, Disrupta - Rou..> | 2025-03-17 20:58 | 6.3M | |
| Diagnostix, Dread MC..> | 2025-03-17 21:18 | 28M | |
| Bou, B Live - F-ck _..> | 2025-03-17 21:50 | 27M | |
| Bou, B Live - F-ck _..> | 2025-03-17 21:51 | 27M | |
| Amplify, Blu Bomma -..> | 2025-03-17 21:51 | 35M | |
| Rendah, Foes - Alter..> | 2025-03-17 21:56 | 33M | |
| Kelvin 373, Waeys, S..> | 2025-03-17 21:57 | 33M | |
| Chase & Status, Stor..> | 2025-03-17 21:58 | 20M | |
| 01. DJ Zinc, Maveric..> | 2025-03-17 22:00 | 9.3M | |
| 01. DJ Zinc, Maveric..> | 2025-03-17 22:03 | 9.3M | |
| Primate, AC13 - Acti..> | 2025-03-17 22:10 | 25M | |
| Mozey, Basslayerz - ..> | 2025-03-17 22:17 | 23M | |
| Tantrum Desire - Clu..> | 2025-03-17 22:22 | 30M | |
| Ray Volpe – Laserb..> | 2025-03-17 22:57 | 6.4M | |
| John Summit, Sub Foc..> | 2025-03-17 22:59 | 28M | |
| Vluarr, Arcando, DRZ..> | 2025-03-17 23:03 | 15M | |
| Serum, The Riddler -..> | 2025-03-17 23:05 | 24M | |
| Chase & Status, Hede..> | 2025-03-17 23:16 | 25M | |
| Hedex, Eksman - MHIT..> | 2025-03-17 23:20 | 23M | |
| Diagnostix, DJ Limit..> | 2025-03-17 23:23 | 25M | |
| Atmos - Nasty.flac | 2025-03-17 23:29 | 31M | |
| Friction vs Jonny L ..> | 2025-03-17 23:32 | 7.9M | |
| 19083190_Rudeboy_(Vo..> | 2025-03-17 23:37 | 8.6M | |
| 09 - Waiting (feat. ..> | 2025-03-17 23:42 | 9.0M | |
| Wilkinson, Kelli-Lei..> | 2025-03-17 23:50 | 30M | |
| SF-Solar System.mp3 | 2025-03-17 23:56 | 12M | |
| Phibes - Man Come Ba..> | 2025-03-17 23:57 | 7.5M | |
| 1991, Mugatu - Cyclo..> | 2025-03-18 00:02 | 31M | |
| Amplify, P Money - O..> | 2025-03-18 00:03 | 18M | |
| S.P.Y. - Spire.flac | 2025-03-18 00:06 | 32M | |
| DJ Fresh - Gold Dust..> | 2025-03-18 00:07 | 9.1M | |
| Ricky West - Poshmit..> | 2025-03-18 00:08 | 29M | |
| TSUKI - Heaven.flac | 2025-03-18 00:10 | 27M | |
| Don Diablo, P Money ..> | 2025-03-18 00:12 | 8.2M | |
| Kanine - Light It Up..> | 2025-03-18 00:13 | 29M | |
| Jazzy - NRG (Skepsis..> | 2025-03-18 00:14 | 20M | |
| 01. Friction - Good ..> | 2025-03-18 00:17 | 7.2M | |
| Dimension ft. Sharle..> | 2025-03-18 00:18 | 10M | |
| Bushbaby - DESIRE96 ..> | 2025-03-18 00:19 | 31M | |
| 01. Bru-C & Simula -..> | 2025-03-18 00:22 | 8.3M | |
| The Prodigy - Breath..> | 2025-03-18 00:22 | 8.7M | |
| REAPER, Pirapus - BL..> | 2025-03-18 00:23 | 27M | |
| Friction, Stylo G, R..> | 2025-03-18 00:24 | 23M | |
| Vibe Chemistry - Bal..> | 2025-03-18 00:25 | 35M | |
| AC13 - Awake.mp3 | 2025-03-18 00:26 | 14M | |
| UK APACHE - ORIGINAL..> | 2025-03-18 00:29 | 8.8M | |
| SOTA - Wait For Me.flac | 2025-03-18 00:31 | 24M | |
| Serum, Basslayerz, M..> | 2025-03-18 00:32 | 20M | |
| Pirapus - GO BACK (W..> | 2025-03-18 00:35 | 29M | |
| 01. Burro Banton & C..> | 2025-03-18 00:41 | 6.9M | |
| Critical Impact - Te..> | 2025-03-18 00:43 | 38M | |
| SOTA, Circadian, Mil..> | 2025-03-18 00:52 | 37M | |
| Rova - Eyes On Me (P..> | 2025-03-18 00:56 | 23M | |
| Arcando - Don't Tell..> | 2025-03-18 00:57 | 22M | |
| Dimension - Offender..> | 2025-03-18 01:12 | 8.7M | |
| Arcando - Don't Tell..> | 2025-03-18 02:56 | 23M | |
| 16504523_Move Your B..> | 2025-03-18 03:41 | 37M | |
| Tsuki - Lights.wav | 2025-03-18 03:41 | 42M | |
| Arcando, Hachi Day -..> | 2025-03-18 13:29 | 26M | |
| Aitch, Bou - Raving ..> | 2025-03-18 13:30 | 20M | |
| Dirty Love (feat. Ta..> | 2025-03-18 13:40 | 5.8M | |
| Bou, IRAH, Kanine & ..> | 2025-03-18 13:45 | 7.7M | |
| Hamdi - Counting (Si..> | 2025-03-18 13:45 | 17M | |
| Entity, Yen - Snake ..> | 2025-03-18 13:46 | 34M | |
| DJ Fresh, EricConger..> | 2025-03-18 13:48 | 26M | |
| 01. Metrik - Utopia.mp3 | 2025-03-18 13:50 | 9.8M | |
| Sox - Brum to Ibiza ..> | 2025-03-18 13:50 | 35M | |
| Yussi - Worth The Lo..> | 2025-03-18 13:52 | 34M | |
| Mr Traumatik, Temple..> | 2025-03-18 14:01 | 26M | |
| Phibes - Kid Cudi - ..> | 2025-03-18 14:04 | 9.7M | |
| Captain Bass - Party..> | 2025-03-18 14:05 | 21M | |
| Sub Focus, Katy B - ..> | 2025-03-18 14:07 | 25M | |
| Hedex - Rhythm & Gas..> | 2025-03-18 14:10 | 19M | |
| SOTA - Machete (A.M...> | 2025-03-18 14:11 | 25M | |
| Bru-C ft. Wilkinson ..> | 2025-03-18 14:12 | 7.8M | |
| Bru-C - No Excuses (..> | 2025-03-18 14:12 | 6.7M | |
| Bru-C & Bou - Street..> | 2025-03-18 14:13 | 8.5M | |
| Basstripper - Hazmat..> | 2025-03-18 14:13 | 26M | |
| Kings Of The Rollers..> | 2025-03-18 14:23 | 7.7M | |
| Kings Of The Rollers..> | 2025-03-18 14:24 | 39M | |
| Mozey, Rusko - Hands..> | 2025-03-18 14:25 | 26M | |
| James Hiraeth, Natha..> | 2025-03-18 14:25 | 27M | |
| 9147623_Alone_in_the..> | 2025-03-18 14:27 | 10M | |
| Simula - Behemoth.flac | 2025-03-18 14:28 | 34M | |
| KEYS & KRATES - DUM ..> | 2025-03-18 14:40 | 9.7M | |
| Rihanna - Diamonds (..> | 2025-03-18 14:41 | 44M | |
| Scooter - The Logica..> | 2025-03-18 14:42 | 34M | |
| Creeds - Push Up (Si..> | 2025-03-18 14:42 | 9.7M | |
| Katy B - On A Missio..> | 2025-03-18 14:43 | 7.8M | |
| MEEKZ - HOODS HOTTES..> | 2025-03-18 14:43 | 38M | |
| JAYBEE - I SEE U BBY..> | 2025-03-18 14:44 | 39M | |
| Skrillex x Foreign B..> | 2025-03-18 14:44 | 27M | |
| Joy Orbison - flight..> | 2025-03-18 15:07 | 9.7M | |
| Bish & Diagnostix - ..> | 2025-03-18 15:18 | 45M | |
| FURNISS - PIRATE MAT..> | 2025-03-18 15:18 | 36M | |
| MIA - PAPER PLANES (..> | 2025-03-18 15:19 | 4.5M | |
| 01. Kings Of Leon - ..> | 2025-03-18 15:20 | 40M | |
| JayBee & MC Doe - Th..> | 2025-03-18 15:20 | 32M | |
| KE$HA - BLAH BLAH BL..> | 2025-03-18 15:21 | 33M | |
| ANIMALS [SHREDDY BOO..> | 2025-03-18 15:21 | 49M | |
| Kenya Grace - Strang..> | 2025-03-18 15:21 | 62M | |
| Rudimental - Ram Pam..> | 2025-03-18 15:22 | 4.5M | |
| Baddadan (TANTRON Bo..> | 2025-03-18 15:22 | 52M | |
| Adam F - Circles (Po..> | 2025-03-18 15:23 | 50M | |
| Eric Prydz - Pjanoo ..> | 2025-03-18 15:23 | 58M | |
| BURT COPE - NASTY DU..> | 2025-03-18 15:23 | 59M | |
| Pump It (TANTRON Boo..> | 2025-03-18 15:24 | 43M | |
| Rendah - Cheese Mong..> | 2025-03-18 15:24 | 57M | |
| INFECTED - MR HAPPY ..> | 2025-03-18 15:24 | 53M | |
| Tiësto, Hedex, Bass..> | 2025-03-18 15:25 | 40M | |
| Daymu - Revolution (..> | 2025-03-18 15:25 | 58M | |
| Metrik - Cadence VIP..> | 2025-03-18 15:26 | 42M | |
| Pendulum - Tarantula..> | 2025-03-18 15:26 | 68M | |
| Wilkinson - Take You..> | 2025-03-18 15:27 | 11M | |
| FRED AGAIN - LEAVEME..> | 2025-03-18 15:27 | 54M | |
| 01 - We Got It.flac | 2025-03-18 15:36 | 29M | |
| 11_Chase & Status (f..> | 2025-03-18 18:14 | 60M | |
| Bicep - Glue (Kanine..> | 2025-03-18 18:14 | 57M | |
| Culture Shock - Brea..> | 2025-03-18 18:14 | 39M | |
| Formula - Baianá Du..> | 2025-03-18 18:14 | 44M | |
| Future - Turn On The..> | 2025-03-18 18:14 | 40M | |
| SKEPTA - THATS NOT M..> | 2025-03-18 18:14 | 46M | |
| Sota - G6 Dub [FREE ..> | 2025-03-18 18:14 | 25M | |
| USHER - YEAH (JAYFOR..> | 2025-03-18 18:14 | 30M | |
| Simula - Venator.flac | 2025-03-19 16:32 | 30M | |
| Circadian - Energy I..> | 2025-03-19 16:40 | 35M | |
| Airglo - Sandstorm.flac | 2025-03-19 17:40 | 23M | |
| ShockOne - Say Woah ..> | 2025-03-19 17:40 | 24M | |
| Rendah, Burrahz - DT..> | 2025-03-19 17:41 | 29M | |
| Zapya - Let You Know..> | 2025-03-19 17:41 | 35M | |
| DON DARKOE - Backsid..> | 2025-03-19 17:43 | 26M | |
| Sub Zero, Captain Ba..> | 2025-03-19 17:44 | 23M | |
| Toxinate - Backhand ..> | 2025-03-19 17:51 | 35M | |
| Phibes - Never Get E..> | 2025-03-19 18:51 | 9.2M | |
| Toxinate - Release y..> | 2025-03-19 18:58 | 32M | |
| Toxinate - Nope.flac | 2025-03-19 18:58 | 27M | |
| Premium, Toxinate, M..> | 2025-03-19 19:00 | 6.5M | |
| Toxinate - So Much L..> | 2025-03-19 19:01 | 7.9M | |
| Toxinate - The End O..> | 2025-03-19 19:01 | 11M | |
| SOTA & Primate - Rea..> | 2025-03-19 19:09 | 8.1M | |
| SOTA - Pray For Me.flac | 2025-03-19 19:09 | 24M | |
| K Motionz - Beaminâ€..> | 2025-03-19 19:15 | 28M | |
| K Motionz, ArrDee, R..> | 2025-03-19 19:15 | 19M | |
| K Motionz, Subsonic ..> | 2025-03-19 19:15 | 9.4M | |
| Mefjus, Camo & Krook..> | 2025-03-19 19:18 | 30M | |
| Sub Focus - Fine Day..> | 2025-03-19 20:15 | 29M | |
| 11018210_Lights_Orig..> | 2025-03-19 20:25 | 11M | |
| The Prototypes, Kudu..> | 2025-03-19 20:27 | 10M | |
| Toxinate, Slipz, MC ..> | 2025-03-19 20:40 | 11M | |
| KEYS & KRATES - DUM ..> | 2025-03-19 20:42 | 7.2M | |
| Move your body (Lumi..> | 2025-03-19 20:42 | 48M | |
| HDILLA [UK] - DON'T ..> | 2025-03-19 20:43 | 67M | |
| Disrupta, Liam Baile..> | 2025-03-19 23:24 | 30M | |
| K.A.D, Kak Hatt - Ju..> | 2025-03-19 23:26 | 20M | |
| Turno, Skepsis, Char..> | 2025-03-19 23:27 | 22M | |
| Herbz, Jaybee (UK) -..> | 2025-03-19 23:31 | 9.4M | |
| ¥$ - Carnival (Hyal..> | 2025-03-20 01:48 | 52M | |
| Disrupta, Latte, B L..> | 2025-03-20 01:48 | 69M | |
| TOXINATE - NOT SO BA..> | 2025-03-20 01:48 | 46M | |
| Toxinate Ft. Fello -..> | 2025-03-20 01:48 | 49M | |
| its tricky.mp3 | 2025-03-20 03:38 | 2.8M | |
| itssssss.mp3 | 2025-03-20 14:04 | 2.1M | |
| its trickkkyyy.mp3 | 2025-03-20 14:55 | 2.9M | |
| Sub Focus - Illumina..> | 2025-03-20 15:23 | 7.0M | |
| TSUKI - Heaven (1).flac | 2025-03-22 00:00 | 27M | |
| State of Mind & Copp..> | 2025-03-22 13:13 | 9.8M | |
| Teddy Killerz - Feed..> | 2025-03-22 13:14 | 30M | |
| Wilkinson - Sweet Li..> | 2025-03-22 13:15 | 8.1M | |
| Phibes - I Dont Give..> | 2025-03-22 13:15 | 8.7M | |
| Voltage, Strategy, S..> | 2025-03-22 13:22 | 21M | |
| Primate - BeatBack.flac | 2025-03-31 05:48 | 27M | |
| K Motionz - Trapline..> | 2025-03-31 05:51 | 29M | |
| Rendah - Intruder (O..> | 2025-03-31 05:58 | 32M | |
| AC13 - Blood Moon.flac | 2025-04-01 17:04 | 26M | |
| Primate, Captain Bas..> | 2025-04-01 17:07 | 28M | |
| Primate, Majistrate,..> | 2025-04-01 17:09 | 26M | |
| Sully, Peekaboo - Ea..> | 2025-04-01 21:30 | 25M | |
| Circadian - Body Wor..> | 2025-04-02 16:37 | 34M | |
| Circadian - Body Wor..> | 2025-04-02 16:37 | 32M | |
| Macky Gee, DON DARKO..> | 2025-04-02 16:40 | 23M | |
| Tesen, DJ Millz - Th..> | 2025-04-02 17:54 | 31M | |
| Star.One, SoulState ..> | 2025-04-02 18:12 | 19M | |
| Bennie - Analog Afte..> | 2025-04-02 18:13 | 11M | |
| Fragma - Toca's Mira..> | 2025-04-02 18:18 | 12M | |
| Kanine - Light It Up..> | 2025-04-02 18:28 | 29M | |
| Subsonic - Genesis.flac | 2025-04-02 18:29 | 30M | |
| Used, Bou - Tonight ..> | 2025-04-02 20:06 | 12M | |
| Dominator, Turno - B..> | 2025-04-02 20:07 | 40M | |
| Hedex - Liars.mp3 | 2025-04-02 20:12 | 9.6M | |
| FMS - Health Risk.flac | 2025-04-02 20:20 | 36M | |
| Sox - Brum to Ibiza ..> | 2025-04-02 20:38 | 35M | |
| Mozey, Sofia - Run (..> | 2025-04-03 01:06 | 7.0M | |
| BOU - 0961 ft. B LIV..> | 2025-04-03 01:43 | 41M | |
| BOU - ALL U GOTTA DO..> | 2025-04-03 01:43 | 44M | |
| BOU - DEEP INSIDE.wav | 2025-04-03 01:43 | 40M | |
| BOU - DIG THIS.wav | 2025-04-03 01:43 | 40M | |
| BOU - FIGHT TALK ft...> | 2025-04-03 01:43 | 40M | |
| BOU - FRENEMIES.wav | 2025-04-03 01:43 | 40M | |
| BOU - FUCK _ UP VIP ..> | 2025-04-03 01:43 | 40M | |
| BOU - LOSE CONTROL.wav | 2025-04-03 01:43 | 40M | |
| BOU - NAN SLAPPER ft..> | 2025-04-03 01:43 | 44M | |
| BOU - OLD AND SOUR.wav | 2025-04-03 01:43 | 40M | |
| BOU - REACTION.wav | 2025-04-03 01:43 | 40M | |
| BOU - SLCTA.wav | 2025-04-03 01:43 | 40M | |
| WICKED DARK KENZI RE..> | 2025-04-03 01:43 | 50M | |
| Rendah, Nersha - Los..> | 2025-04-03 20:41 | 27M | |
| police.mp3 | 2025-04-04 01:52 | 2.3M | |
| Lando - Wine & Dine ..> | 2025-04-04 02:12 | 23M | |
| 591159261.mp3 | 2025-04-04 02:14 | 3.1M | |
| Bou - La Kasbah.flac | 2025-04-05 00:19 | 26M | |
| Andy C, Becky Hill -..> | 2025-04-06 17:33 | 29M | |
| Turno - Killer VIP.flac | 2025-04-06 17:34 | 32M | |
| Delta Heavy - Ecstas..> | 2025-04-06 17:34 | 25M | |
| Rendah, Jakar - Get ..> | 2025-04-07 16:53 | 11M | |
| TSUKI, Sub Zero, Ell..> | 2025-04-07 16:53 | 27M | |
| Basstripper - In The..> | 2025-04-08 01:01 | 6.4M | |
| Basstripper - Time T..> | 2025-04-08 01:02 | 29M | |
| Netsky, Jazmine John..> | 2025-04-08 01:02 | 30M | |
| Basstripper - Ricoch..> | 2025-04-08 01:04 | 29M | |
| 06-basstripper-noodl..> | 2025-04-08 01:06 | 11M | |
| J Bookey, Eksman - S..> | 2025-04-08 01:10 | 37M | |
| Original Sin, Eksman..> | 2025-04-08 01:13 | 22M | |
| Mampi Swift - Jaws (..> | 2025-04-09 19:16 | 12M | |
| Wilkinson, iiola, To..> | 2025-04-09 19:17 | 46M | |
| MONSS - On Your Mind..> | 2025-04-09 19:17 | 21M | |
| Nazca Linez - Acid F..> | 2025-04-09 19:18 | 12M | |
| youtube_IJjK-Yynjis_..> | 2025-04-09 19:22 | 5.2M | |
| 01. Shy FX feat. MC ..> | 2025-04-09 19:23 | 7.7M | |
| Serum - Stressed Out..> | 2025-04-09 19:34 | 28M | |
| Nick The Lot - Chord..> | 2025-04-10 14:26 | 33M | |
| Majistrate & Logan D..> | 2025-04-10 14:45 | 36M | |
| Sub Zero & Majistrat..> | 2025-04-10 14:49 | 11M | |
| Hedex, Tion Wayne - ..> | 2025-04-10 15:03 | 34M | |
| cassö, RAYE, D-Bloc..> | 2025-04-10 23:37 | 17M | |
| blkout. - crush.flac | 2025-04-10 23:40 | 18M | |
| drowning pool - bodi..> | 2025-04-10 23:42 | 48M | |
| K Trap - Warm (Fusio..> | 2025-04-11 00:05 | 45M | |
| Fisher - Take it off..> | 2025-04-11 00:32 | 5.3M | |
| Chase & Status - Eas..> | 2025-04-11 00:42 | 72M | |
| bdjtsggb2tum.mp3 | 2025-04-11 14:46 | 2.4M | |
| diagnostixstreetfigh..> | 2025-04-11 15:07 | 4.9M | |
| jhggjgjg.mp3 | 2025-04-11 15:15 | 4.8M | |
| X-Ray (Metrik Remix)..> | 2025-04-11 15:34 | 8.9M | |
| 10911984_Round_Ere_O..> | 2025-04-11 18:31 | 46M | |
| Benny Benassi - Sati..> | 2025-04-11 18:31 | 40M | |
| Tinie Tempah - Pass ..> | 2025-04-11 18:31 | 41M | |
| street.mp3 | 2025-04-14 00:52 | 2.4M | |
| Formula - E1.mp3 | 2025-04-14 01:11 | 8.3M | |
| ACP - Foghorn (Atmos..> | 2025-04-14 01:14 | 15M | |
| Azule, ACP - Nasty.mp3 | 2025-04-14 01:15 | 11M | |
| ACP - Dreaming.flac | 2025-04-14 01:17 | 34M | |
| Formula, ACP - Gem S..> | 2025-04-14 01:17 | 31M | |
| Diagnostix - Streetf..> | 2025-04-15 00:14 | 35M | |
| 04 Bou - Spook.flac | 2025-04-15 00:38 | 27M | |
| L Plus - Run It Back..> | 2025-04-15 02:38 | 6.8M | |
| Hedex - No More Figh..> | 2025-04-16 01:10 | 10M | |
| Noisia, The Upbeats ..> | 2025-04-16 17:13 | 14M | |
| Noisia, The Upbeats ..> | 2025-04-16 17:25 | 32M | |
| Jamezy - Money Talks..> | 2025-04-17 18:48 | 9.5M | |
| Kanine - Feel The Vi..> | 2025-04-17 21:28 | 28M | |
| Tsuki - Take Off (Or..> | 2025-04-18 01:13 | 6.4M | |
| Doktor, Benny Page -..> | 2025-04-18 01:16 | 6.7M | |
| Majistrate - Scorpio..> | 2025-04-18 01:27 | 30M | |
| Majistrate - Scorpio..> | 2025-04-18 01:28 | 35M | |
| 01. Burro Banton & C..> | 2025-04-18 01:33 | 7.0M | |
| desire.wav | 2025-04-18 01:34 | 45M | |
| Alex Reece - Pulp Fi..> | 2025-04-18 01:38 | 14M | |
| UK APACHE - ORIGINAL..> | 2025-04-18 02:50 | 8.8M | |
| HERBZ - SHOW ME LOVE..> | 2025-04-18 02:51 | 34M | |
| MEEKZ - HOODS HOTTES..> | 2025-04-18 02:51 | 8.9M | |
| MONT x SPAVEN x HERB..> | 2025-04-18 02:51 | 30M | |
| HERBZ - HARLEM O [FI..> | 2025-04-18 02:52 | 45M | |
| LATTE - THAT'S NOT M..> | 2025-04-18 02:52 | 45M | |
| LATTE - MOTHERLOAD [..> | 2025-04-18 02:52 | 11M | |
| Latte - Bully [VIP].wav | 2025-04-18 02:52 | 45M | |
| RUDIMENTAL - WAITING..> | 2025-04-18 02:53 | 28M | |
| TRAVIS SCOTT - FE!N ..> | 2025-04-18 02:53 | 25M | |
| Sub Focus - Wildfire..> | 2025-04-18 02:54 | 39M | |
| Hannah Laing - Party..> | 2025-04-18 02:54 | 8.3M | |
| Rendah & Burt Cope -..> | 2025-04-18 02:55 | 7.5M | |
| 1. TURNO - UAV ONLIN..> | 2025-04-18 02:55 | 26M | |
| TC - Where's My Mone..> | 2025-04-18 02:55 | 48M | |
| JANDO - Bassline Jun..> | 2025-04-18 02:57 | 44M | |
| Black Sabbath - WAR ..> | 2025-04-18 02:58 | 45M | |
| Zone 2 - No Censor (..> | 2025-04-18 02:59 | 30M | |
| Central Cee - Khabib..> | 2025-04-18 02:59 | 45M | |
| Calvin Harris ft Ell..> | 2025-04-18 02:59 | 46M | |
| RTK - CALYPSO (NVADR..> | 2025-04-18 03:00 | 37M | |
| Juice WRLD - Lucid D..> | 2025-04-18 03:01 | 33M | |
| Lock Stock (Junk Mai..> | 2025-04-18 03:01 | 39M | |
| SOULJA BOY - KISSMET..> | 2025-04-18 03:01 | 32M | |
| TRAVIS SCOTT - BUTTE..> | 2025-04-18 03:02 | 57M | |
| CHRYSTAL - THE DAYS ..> | 2025-04-18 03:03 | 58M | |
| blkout. - dIlemma [b..> | 2025-04-18 03:03 | 41M | |
| drowning pool - bodi..> | 2025-04-18 03:03 | 48M | |
| Diagnostix - Taserz ..> | 2025-04-18 03:04 | 34M | |
| Jamezy - Money Talks..> | 2025-04-18 03:05 | 42M | |
| TS7, Slick Don - Rea..> | 2025-04-18 03:28 | 27M | |
| Tsuki, Mr Traumatik ..> | 2025-04-18 03:30 | 29M | |
| Bou - Trap Phone (DU..> | 2025-04-18 03:40 | 4.5M | |
| Diagnostix - Its Tri..> | 2025-04-18 04:02 | 30M | |
| Diagnostix - Streetf..> | 2025-04-18 04:02 | 35M | |
| Sub Zero - Bounce.flac | 2025-04-19 00:49 | 24M | |
| Sub Zero - Bounce VI..> | 2025-04-19 00:49 | 25M | |
| BlckHry, Magenta - S..> | 2025-04-19 01:10 | 10M | |
| T-Lex - Overthrow (O..> | 2025-04-19 01:17 | 8.2M | |
| T-Lex - Overthink It..> | 2025-04-19 01:19 | 8.8M | |
| Take It Up.mp3 | 2025-04-19 01:45 | 7.3M | |
| Marlon Hoffstadt aka..> | 2025-04-21 14:27 | 28M | |
| Culture Shock - Empi..> | 2025-04-22 23:01 | 33M | |
| Circadian, Mozey - L..> | 2025-04-22 23:13 | 37M | |
| Diagnostix - Streetf..> | 2025-04-22 23:46 | 35M | |
| DJ Zinc, Iyamah - St..> | 2025-04-24 00:36 | 20M | |
| Skelecta, Emz - STEA..> | 2025-04-24 01:20 | 23M | |
| MAU P - DRUGS FROM A..> | 2025-04-24 01:47 | 45M | |
| TC - Tap Ho Remix (F..> | 2025-04-24 01:53 | 8.9M | |
| Sub Zero & Majistrat..> | 2025-04-24 01:56 | 5.2M | |
| Flowdan - Shell A Ve..> | 2025-04-24 02:19 | 45M | |
| SKANTIA - YOYO BOP V..> | 2025-04-24 02:19 | 26M | |
| 07 Alarm.mp3 | 2025-04-24 21:26 | 7.3M | |
| Benny Benassi, The B..> | 2025-04-29 01:56 | 24M | |
| Disrupta, Gentlemens..> | 2025-04-29 01:56 | 20M | |
| Distress Signal - Ho..> | 2025-04-29 02:54 | 28M | |
| Tsuki - Feel That Ba..> | 2025-04-29 02:55 | 31M | |
| 1. Ceadie & Data Roa..> | 2025-04-30 00:13 | 6.8M | |
| Feistling - NUTZ (VI..> | 2025-04-30 00:15 | 20M | |
| Bladerunner - Rave M..> | 2025-04-30 00:16 | 33M | |
| Herbz, Premium, Noir..> | 2025-04-30 00:33 | 23M | |
| youtube_adBS5PYoR88_..> | 2025-04-30 00:56 | 804K | |
| 01. Drum Dad & Bass ..> | 2025-04-30 18:15 | 41M | |
| Alibi - Cause & Effe..> | 2025-04-30 18:15 | 39M | |
| Diagnostix - Malfunc..> | 2025-04-30 21:56 | 8.2M | |
| Tantrum Desire - Unl..> | 2025-04-30 22:01 | 33M | |
| James Hype - Don't W..> | 2025-05-01 23:57 | 20M | |
| K Motionz, Emily Mak..> | 2025-05-01 23:57 | 17M | |
| Vibe Chemistry, MIST..> | 2025-05-02 00:00 | 16M | |
| Samstone - What To S..> | 2025-05-02 00:13 | 23M | |
![[IMG]](/icons/image2.gif) | crying.jpg | 2025-05-02 00:14 | 27K | |
| Phibes - Have Your L..> | 2025-05-02 00:24 | 28M | |
| Phibes - Fredagain -..> | 2025-05-02 00:25 | 9.3M | |
| Phibes - Phibes - Ba..> | 2025-05-02 00:26 | 8.8M | |
| Herbz Jaybee - 50 P..> | 2025-05-02 00:34 | 8.5M | |
| 11 Flashing Lights.mp3 | 2025-05-02 00:35 | 9.6M | |
| Jamezy - Fendi Not F..> | 2025-05-02 01:34 | 42M | |
| Rova - Hellhound.flac | 2025-05-03 01:07 | 18M | |
| Primate - F That.flac | 2025-05-03 01:07 | 32M | |
| 01 Tap Ho (Shapes Re..> | 2025-05-03 01:09 | 7.8M | |
| 02. Sub Zero feat. R..> | 2025-05-03 05:18 | 11M | |
| Gray, Donae'o - Lick..> | 2025-05-03 20:57 | 6.2M | |
| Gray, Donae'o - Squa..> | 2025-05-03 21:36 | 22M | |
| 03 - Rubadub.mp3 | 2025-05-03 21:38 | 12M | |
| Lady Gaga - Just Dan..> | 2025-05-03 21:40 | 50M | |
| ERIC PRYDZ - CALL ON..> | 2025-05-03 22:11 | 5.5M | |
| D.O.D - So Much In L..> | 2025-05-04 00:48 | 9.0M | |
| Skantia - Yoyo Bop.flac | 2025-05-04 00:48 | 26M | |
| Noisia, The Upbeats ..> | 2025-05-04 00:53 | 14M | |
| Annix, Mefjus - Shai..> | 2025-05-04 01:15 | 35M | |
| Simula - Mimic (Orig..> | 2025-05-04 04:37 | 29M | |
| Prodigy - No Good Fo..> | 2025-05-04 05:21 | 8.0M | |
| The Prodigy - Voodoo..> | 2025-05-04 05:22 | 12M | |
| The Prodigy - Smack ..> | 2025-05-04 05:27 | 47M | |
| Mozey - Party Muscle..> | 2025-05-04 05:37 | 33M | |
| SOTA, Circadian, Mil..> | 2025-05-04 05:38 | 37M | |
| Simula - Venator (1)..> | 2025-05-04 05:41 | 30M | |
| Simula - Behemoth (1..> | 2025-05-04 05:41 | 34M | |
| Simula - Bonesaw (K ..> | 2025-05-04 05:41 | 32M | |
| Original Sin, Grace ..> | 2025-05-04 05:43 | 29M | |
| Bou, Slay - Closer (..> | 2025-05-04 05:43 | 22M | |
| Rendah - Rocker.flac | 2025-05-04 05:45 | 32M | |
| 01. Dimension - Devo..> | 2025-05-04 06:12 | 7.3M | |
| 01. Sub Focus - Time..> | 2025-05-04 06:12 | 8.9M | |
| Culture Shock - Rena..> | 2025-05-04 06:16 | 8.2M | |
| AC13, Eskman - POW.flac | 2025-05-04 06:20 | 34M | |
| T95 - Bounce.mp3 | 2025-05-04 06:23 | 9.4M | |
| Mario Underground - ..> | 2025-05-04 06:25 | 35M | |
| Rudimental, Skepsis,..> | 2025-05-04 06:30 | 24M | |
| Slipz, Amplify - Bla..> | 2025-05-04 06:31 | 40M | |
| Toxinate, Captain Ba..> | 2025-05-04 06:33 | 21M | |
| Toxinate - Heat.mp3 | 2025-05-04 06:35 | 10M | |
| Tsuki - Take Off (Or..> | 2025-05-04 23:51 | 20M | |
| Vibe Chemistry - Loc..> | 2025-05-05 00:11 | 28M | |
| Wigman, R3dX - Set M..> | 2025-05-05 00:27 | 11M | |
| Skepsis, Doktor - Ar..> | 2025-05-05 00:49 | 21M | |
| Kenya Grace - Strang..> | 2025-05-05 00:50 | 62M | |
| Gino, P Money - Vill..> | 2025-05-05 00:50 | 24M | |
| Skepsis, Haribo - Mo..> | 2025-05-05 00:51 | 34M | |
| J Bookey, Kaye - Hea..> | 2025-05-05 00:52 | 38M | |
| Rendah - Tension.flac | 2025-05-05 00:53 | 31M | |
| Gino - Rush Wave.flac | 2025-05-05 00:53 | 27M | |
| 11074038_Want_You_Or..> | 2025-05-05 00:54 | 9.6M | |
| Kanine - Take Me Up...> | 2025-05-05 00:54 | 51M | |
| 03. Eptic - Space Bu..> | 2025-05-05 00:57 | 37M | |
| TSUKI - Take You Hig..> | 2025-05-05 00:58 | 29M | |
| J Bookey, Statera - ..> | 2025-05-05 01:00 | 12M | |
| Phibes - Kid Cudi - ..> | 2025-05-05 01:03 | 9.7M | |
| Don Diablo, P Money ..> | 2025-05-05 01:03 | 8.2M | |
| Jazzy - NRG (Skepsis..> | 2025-05-05 01:04 | 20M | |
| J Bookey, Captain Ba..> | 2025-05-05 01:05 | 24M | |
| Holy Goof & Takura -..> | 2025-05-05 01:05 | 11M | |
| 01. Friction - Good ..> | 2025-05-05 01:06 | 7.2M | |
| Krakota, Fred V & TU..> | 2025-05-05 01:08 | 10M | |
| Armin van Buuren - L..> | 2025-05-05 01:11 | 9.4M | |
| Philip George, Shape..> | 2025-05-05 01:11 | 28M | |
| Protoje feat. Chroni..> | 2025-05-05 01:12 | 9.6M | |
| Whip Slap II.mp3 | 2025-05-05 01:23 | 8.6M | |
| RAMONES - BLITZKRIEG..> | 2025-05-05 01:39 | 33M | |
| Atmos - Dutty Gyal.flac | 2025-05-06 01:17 | 32M | |
| Atmos - Hold You.flac | 2025-05-06 01:18 | 26M | |
| 365 HOT. ( FREE DOWN..> | 2025-05-06 01:28 | 3.7M | |
| OVERIDE ( FREE DOWNL..> | 2025-05-06 01:28 | 3.7M | |
| DREAM (1K FOLLOWERS ..> | 2025-05-06 01:30 | 3.4M | |
| Sota & Primate - Rea..> | 2025-05-06 01:54 | 35M | |
| METAVB001D-002-Benny..> | 2025-05-06 17:58 | 55M | |
| DJ STEPHANIE - GROOV..> | 2025-05-06 17:59 | 9.0M | |
| Formula - VIP(dance ..> | 2025-05-06 17:59 | 36M | |
| FURNISS - SORRY 24.wav | 2025-05-06 18:00 | 68M | |
| ACCUSATIONS ( With J..> | 2025-05-06 18:00 | 3.3M | |
| SAMURAI BREAKS & KRE..> | 2025-05-06 18:00 | 2.7M | |
| BAZ - HYPNOTISED.wav | 2025-05-06 18:01 | 33M | |
| BAZ - 365 HOT.wav | 2025-05-06 18:01 | 41M | |
| BAZ - OVERIDE DUB (..> | 2025-05-06 18:01 | 41M | |
| BAZ- DREAM.wav | 2025-05-06 18:01 | 61M | |
| Sota x Eksman - The ..> | 2025-05-06 18:01 | 22M | |
| Chase And Status, Bu..> | 2025-05-06 18:02 | 1.2M | |
| Protoje feat. Chroni..> | 2025-05-06 18:02 | 42M | |
| SAMMY VIRJI - If U N..> | 2025-05-06 18:03 | 36M | |
| Levity - Flip It (Br..> | 2025-05-06 18:03 | 34M | |
| Ms Dynamite - Wile O..> | 2025-05-06 18:03 | 10M | |
| Dr. Dre - The Next E..> | 2025-05-06 18:04 | 40M | |
| DIAGNOSTIX - BUMBACL..> | 2025-05-06 18:05 | 26M | |
| DIAGNOSTIX - 90S FUZ..> | 2025-05-06 18:05 | 32M | |
| DIAGNOSTIX - NOTTING..> | 2025-05-06 18:05 | 33M | |
| DIAGNOSTIX - SPITFIR..> | 2025-05-06 18:06 | 44M | |
| DIAGNOSTIX - FESTER ..> | 2025-05-06 18:06 | 28M | |
| DIAGNOSTIX - MAN A S..> | 2025-05-06 18:06 | 37M | |
| DIAGNOSTIX - SHABBA ..> | 2025-05-06 18:06 | 32M | |
| DIAGNOSTIX - ITS TRI..> | 2025-05-06 18:07 | 31M | |
| John Summit & HAYLA ..> | 2025-05-06 18:07 | 44M | |
| J BOOKEY - WHITE NOI..> | 2025-05-06 18:07 | 46M | |
| CALVIN HARRIS - NOT ..> | 2025-05-06 18:08 | 12M | |
| AJ Tracey - Seoul (O..> | 2025-05-06 18:08 | 49M | |
| K-TRAP - WARM (ODAN ..> | 2025-05-06 18:09 | 68M | |
| Chase & Status - Sel..> | 2025-05-06 18:09 | 33M | |
| CHASE & STATUS - CEN..> | 2025-05-06 18:09 | 7.9M | |
| Marshmello & Space L..> | 2025-05-06 18:09 | 4.9M | |
| Wilkinson & TALAY RI..> | 2025-05-06 18:10 | 8.6M | |
| Stay High x Black Ou..> | 2025-05-06 18:10 | 23M | |
| The Prodigy - No Goo..> | 2025-05-06 18:10 | 46M | |
| Burt Cope - Outta My..> | 2025-05-06 18:10 | 42M | |
| SHOW ME LOVE X AJ TR..> | 2025-05-06 18:11 | 4.7M | |
| skantia - Gatwick Gr..> | 2025-05-06 18:11 | 41M | |
| Darkzy - Cry Me A Ri..> | 2025-05-06 18:11 | 30M | |
| Dominator & Logan D ..> | 2025-05-06 18:11 | 48M | |
| 4K - I.GOT.U (@4KDUB..> | 2025-05-06 18:12 | 42M | |
| SAMSTONE - UK RAP [V..> | 2025-05-06 18:12 | 44M | |
| Camila Cabello - Cry..> | 2025-05-06 18:12 | 50M | |
| Critical Impact - Te..> | 2025-05-06 18:13 | 10M | |
| 03_Censor (feat. Pop..> | 2025-05-06 18:13 | 59M | |
| Gray - Sun Goes Down..> | 2025-05-06 18:13 | 32M | |
| D.O.D - So Much In L..> | 2025-05-06 18:14 | 9.0M | |
| Dominator & Logan D ..> | 2025-05-06 18:14 | 70M | |
| DIAGNOSTIX - RUN FOR..> | 2025-05-06 18:14 | 44M | |
| DIAGNOSTIX - FOG RID..> | 2025-05-06 18:15 | 28M | |
| DIAGNOSTIX - BUN ONE..> | 2025-05-06 18:15 | 31M | |
| DIAGNOSTIX - COOKED ..> | 2025-05-06 18:15 | 28M | |
| Stardust - Music Sou..> | 2025-05-06 18:16 | 46M | |
| Boombastic Edit.wav | 2025-05-06 18:16 | 22M | |
| Switch Disco, Ella H..> | 2025-05-06 18:41 | 26M | |
| Culture Shock, Grafi..> | 2025-05-08 17:46 | 30M | |
| 1991, Rova - Hijack...> | 2025-05-08 17:47 | 22M | |
| Friction, Basslayerz..> | 2025-05-09 00:22 | 21M | |
| Latte - Everybody Sk..> | 2025-05-09 00:22 | 23M | |
| Move It.wav | 2025-05-09 17:25 | 38M | |
| DJ Pleasure - Popcor..> | 2025-05-11 20:00 | 30M | |
| Basstripper - In The..> | 2025-05-12 17:47 | 20M | |
| Becky Hill, Chase & ..> | 2025-05-12 17:49 | 7.5M | |
| Teddy Killerz - Nigh..> | 2025-05-12 17:50 | 11M | |
| Turno, Basslayerz - ..> | 2025-05-12 17:50 | 29M | |
| Selecta J-Man, Suku ..> | 2025-05-12 17:51 | 27M | |
| 01 No Problem.mp3 | 2025-05-12 18:17 | 9.6M | |
| Formula - Automatech..> | 2025-05-12 18:18 | 44M | |
| Matapiro, Moskidzo -..> | 2025-05-15 01:06 | 29M | |
| Professor Green - Ju..> | 2025-05-16 02:04 | 45M | |
| Sota - CANUFEELMYHEA..> | 2025-05-17 00:02 | 20M | |
| Sota - Wait For Me V..> | 2025-05-17 00:02 | 33M | |
| Bou - Spook (Entity ..> | 2025-05-19 23:53 | 41M | |
| Tessela - Hackney Pa..> | 2025-05-20 00:23 | 42M | |
| Tessela - Hackney Pa..> | 2025-05-20 00:23 | 38M | |
| PIRAPUS - SUPER DUB ..> | 2025-05-20 02:17 | 8.0M | |
|
|---|
Apache/2.4.54 (Win64) PHP/8.0.26 mod_fcgid/2.3.10-dev Server at promfiles.me Port 80
